C26H28FN3O8S2 — CID 71465374
2-[4-[[(2S)-4-fluoro-1-(hydroxyamino)-1-oxopent-4-en-2-yl]-(pyridin-3-ylmethyl)sulfamoyl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 71465374) has the molecular formula C26H28FN3O8S2 and a molecular weight of 593.66 g/mol. Its IUPAC name is 2-[4-[[(2S)-4-fluoro-1-(hydroxyamino)-1-oxopent-4-en-2-yl]-(pyridin-3-ylmethyl)sulfamoyl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[[(2S)-4-fluoro-1-(hydroxyamino)-1-oxopent-4-en-2-yl]-(pyridin-3-ylmethyl)sulfamoyl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71465374 |
| Molecular Formula | C26H28FN3O8S2 |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | 2-[4-[[(2S)-4-fluoro-1-(hydroxyamino)-1-oxopent-4-en-2-yl]-(pyridin-3-ylmethyl)sulfamoyl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | C=C(F)C[C@@H](C(=O)NO)N(Cc1cccnc1)S(=O)(=O)c1ccc(OCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H28FN3O8S2/c1-19-5-9-24(10-6-19)40(35,36)38-15-14-37-22-7-11-23(12-8-22)39(33,34)30(18-21-4-3-13-28-17-21)25(16-20(2)27)26(31)29-32/h3-13,17,25,32H,2,14-16,18H2,1H3,(H,29,31)/t25-/m0/s1 |
| InChIKey | XVGCXKCWMULZJN-VWLOTQADSA-N |
| XLogP | 3.11 |
| TPSA | 152.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|