C21H24FNO5S — CID 89136703
(2S)-2-[benzyl-(4-propoxyphenyl)sulfonylamino]-4-fluoropent-4-enoic acid (PubChem CID 89136703) has the molecular formula C21H24FNO5S and a molecular weight of 421.49 g/mol. Its IUPAC name is (2S)-2-[benzyl-(4-propoxyphenyl)sulfonylamino]-4-fluoropent-4-enoic acid.
| Compound Name | (2S)-2-[benzyl-(4-propoxyphenyl)sulfonylamino]-4-fluoropent-4-enoic acid |
|---|---|
| PubChem CID | 89136703 |
| Molecular Formula | C21H24FNO5S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (2S)-2-[benzyl-(4-propoxyphenyl)sulfonylamino]-4-fluoropent-4-enoic acid |
| SMILES | C=C(F)C[C@@H](C(=O)O)N(Cc1ccccc1)S(=O)(=O)c1ccc(OCCC)cc1 |
| InChI | InChI=1S/C21H24FNO5S/c1-3-13-28-18-9-11-19(12-10-18)29(26,27)23(15-17-7-5-4-6-8-17)20(21(24)25)14-16(2)22/h4-12,20H,2-3,13-15H2,1H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | HJSOKZBSICJSSJ-FQEVSTJZSA-N |
| XLogP | 3.99 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |