C20H25NO5S — CID 22907064
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 22907064) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22907064 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)C(CC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-15(2)13-19(20(22)23)21(14-16-7-5-4-6-8-16)27(24,25)18-11-9-17(26-3)10-12-18/h4-12,15,19H,13-14H2,1-3H3,(H,22,23) |
| InChIKey | BIBOWTHSASYDGJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |