C20H23N5O5S — CID 22856287
methyl (2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(1-methyltetrazol-5-yl)propanoate (PubChem CID 22856287) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is methyl (2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(1-methyltetrazol-5-yl)propanoate.
| Compound Name | methyl (2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(1-methyltetrazol-5-yl)propanoate |
|---|---|
| PubChem CID | 22856287 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | methyl (2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(1-methyltetrazol-5-yl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1nnnn1C)N(Cc1ccccc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H23N5O5S/c1-24-19(21-22-23-24)13-18(20(26)30-3)25(14-15-7-5-4-6-8-15)31(27,28)17-11-9-16(29-2)10-12-17/h4-12,18H,13-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | NGUMTYSJQQBPJF-GOSISDBHSA-N |
| XLogP | 1.19 |
| TPSA | 116.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |