C25H35N3O6S — CID 22856292
methyl (2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-6-[[2-(dimethylamino)acetyl]amino]hexanoate (PubChem CID 22856292) has the molecular formula C25H35N3O6S and a molecular weight of 505.64 g/mol. Its IUPAC name is methyl (2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-6-[[2-(dimethylamino)acetyl]amino]hexanoate.
| Compound Name | methyl (2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-6-[[2-(dimethylamino)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 22856292 |
| Molecular Formula | C25H35N3O6S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | methyl (2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-6-[[2-(dimethylamino)acetyl]amino]hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)CN(C)C)N(Cc1ccccc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H35N3O6S/c1-27(2)19-24(29)26-17-9-8-12-23(25(30)34-4)28(18-20-10-6-5-7-11-20)35(31,32)22-15-13-21(33-3)14-16-22/h5-7,10-11,13-16,23H,8-9,12,17-19H2,1-4H3,(H,26,29)/t23-/m1/s1 |
| InChIKey | ANRSYOUSHGUOND-HSZRJFAPSA-N |
| XLogP | 2.28 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|