C18H20FN3O5S — CID 71465371
(2R)-4-fluoro-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]pent-4-enamide (PubChem CID 71465371) has the molecular formula C18H20FN3O5S and a molecular weight of 409.44 g/mol. Its IUPAC name is (2R)-4-fluoro-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]pent-4-enamide.
| Compound Name | (2R)-4-fluoro-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]pent-4-enamide |
|---|---|
| PubChem CID | 71465371 |
| Molecular Formula | C18H20FN3O5S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (2R)-4-fluoro-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]pent-4-enamide |
| SMILES | C=C(F)C[C@H](C(=O)NO)N(Cc1cccnc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H20FN3O5S/c1-13(19)10-17(18(23)21-24)22(12-14-4-3-9-20-11-14)28(25,26)16-7-5-15(27-2)6-8-16/h3-9,11,17,24H,1,10,12H2,2H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | FWGLYVKGDMYORU-QGZVFWFLSA-N |
| XLogP | 2.03 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|