C21H28N2O5S — CID 70956889
tert-butyl (2S)-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]butanoate (PubChem CID 70956889) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]butanoate.
| Compound Name | tert-butyl (2S)-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]butanoate |
|---|---|
| PubChem CID | 70956889 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | tert-butyl (2S)-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]butanoate |
| SMILES | CC[C@@H](C(=O)OC(C)(C)C)N(Cc1cccnc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28N2O5S/c1-6-19(20(24)28-21(2,3)4)23(15-16-8-7-13-22-14-16)29(25,26)18-11-9-17(27-5)10-12-18/h7-14,19H,6,15H2,1-5H3/t19-/m0/s1 |
| InChIKey | HWBUMWMGMBRSTB-IBGZPJMESA-N |
| XLogP | 3.40 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |