C25H24N4O7S — CID 20610884
(2S)-4-(1,3-dioxoisoindol-2-yl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]butanamide (PubChem CID 20610884) has the molecular formula C25H24N4O7S and a molecular weight of 524.56 g/mol. Its IUPAC name is (2S)-4-(1,3-dioxoisoindol-2-yl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]butanamide.
| Compound Name | (2S)-4-(1,3-dioxoisoindol-2-yl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]butanamide |
|---|---|
| PubChem CID | 20610884 |
| Molecular Formula | C25H24N4O7S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | (2S)-4-(1,3-dioxoisoindol-2-yl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]butanamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)[C@@H](CCN2C(=O)c3ccccc3C2=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C25H24N4O7S/c1-36-18-8-10-19(11-9-18)37(34,35)29(16-17-5-4-13-26-15-17)22(23(30)27-33)12-14-28-24(31)20-6-2-3-7-21(20)25(28)32/h2-11,13,15,22,33H,12,14,16H2,1H3,(H,27,30)/t22-/m0/s1 |
| InChIKey | YXSRNEPOGRAAEF-QFIPXVFZSA-N |
| XLogP | 1.84 |
| TPSA | 146.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|