C18H23N3O5S — CID 170380866
(2S)-N-hydroxy-2-[(4-hydroxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-4-methylpentanamide (PubChem CID 170380866) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[(4-hydroxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-4-methylpentanamide.
| Compound Name | (2S)-N-hydroxy-2-[(4-hydroxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 170380866 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (2S)-N-hydroxy-2-[(4-hydroxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(=O)NO)N(Cc1cccnc1)S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H23N3O5S/c1-13(2)10-17(18(23)20-24)21(12-14-4-3-9-19-11-14)27(25,26)16-7-5-15(22)6-8-16/h3-9,11,13,17,22,24H,10,12H2,1-2H3,(H,20,23)/t17-/m0/s1 |
| InChIKey | IHWGIWICLCJWDY-KRWDZBQOSA-N |
| XLogP | 1.90 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|