C26H32O4SSi — CID 14616924
3-[tert-butyl(diphenyl)silyl]oxypropyl 4-methylbenzenesulfonate (PubChem CID 14616924) has the molecular formula C26H32O4SSi and a molecular weight of 468.69 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxypropyl 4-methylbenzenesulfonate.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxypropyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14616924 |
| Molecular Formula | C26H32O4SSi |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxypropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H32O4SSi/c1-22-16-18-23(19-17-22)31(27,28)29-20-11-21-30-32(26(2,3)4,24-12-7-5-8-13-24)25-14-9-6-10-15-25/h5-10,12-19H,11,20-21H2,1-4H3 |
| InChIKey | NJBNQFZXAGKOEN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|