C24H36O4SSi — CID 10599605
[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-phenylpentyl] 4-methylbenzenesulfonate (PubChem CID 10599605) has the molecular formula C24H36O4SSi and a molecular weight of 448.70 g/mol. Its IUPAC name is [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-phenylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-phenylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10599605 |
| Molecular Formula | C24H36O4SSi |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-phenylpentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@@](C)(O[Si](C)(C)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H36O4SSi/c1-20-14-16-22(17-15-20)29(25,26)27-19-11-18-24(5,21-12-9-8-10-13-21)28-30(6,7)23(2,3)4/h8-10,12-17H,11,18-19H2,1-7H3/t24-/m1/s1 |
| InChIKey | NRLYVWKOSUHBLH-XMMPIXPASA-N |
| XLogP | 6.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|