C32H35NO3S — CID 11562580
6-(tritylamino)hexyl 4-methylbenzenesulfonate (PubChem CID 11562580) has the molecular formula C32H35NO3S and a molecular weight of 513.70 g/mol. Its IUPAC name is 6-(tritylamino)hexyl 4-methylbenzenesulfonate.
| Compound Name | 6-(tritylamino)hexyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11562580 |
| Molecular Formula | C32H35NO3S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 6-(tritylamino)hexyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCNC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H35NO3S/c1-27-21-23-31(24-22-27)37(34,35)36-26-14-3-2-13-25-33-32(28-15-7-4-8-16-28,29-17-9-5-10-18-29)30-19-11-6-12-20-30/h4-12,15-24,33H,2-3,13-14,25-26H2,1H3 |
| InChIKey | NKQISFHSSRVOJW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|