C15H26O4SSi — CID 169435361
[2-[tert-butyl(dimethyl)silyl]oxy-1,1-dideuterioethyl] 4-methylbenzenesulfonate (PubChem CID 169435361) has the molecular formula C15H26O4SSi and a molecular weight of 332.53 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-1,1-dideuterioethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-1,1-dideuterioethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169435361 |
| Molecular Formula | C15H26O4SSi |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-1,1-dideuterioethyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(CO[Si](C)(C)C(C)(C)C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H26O4SSi/c1-13-7-9-14(10-8-13)20(16,17)18-11-12-19-21(5,6)15(2,3)4/h7-10H,11-12H2,1-6H3/i11D2 |
| InChIKey | SURVAMFPFPDSHK-ZWGOZCLVSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|