C21H38O4SSi — CID 140752000
[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-propylpentyl] 4-methylbenzenesulfonate (PubChem CID 140752000) has the molecular formula C21H38O4SSi and a molecular weight of 414.68 g/mol. Its IUPAC name is [(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-propylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-propylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 140752000 |
| Molecular Formula | C21H38O4SSi |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | [(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-propylpentyl] 4-methylbenzenesulfonate |
| SMILES | CCC[C@H](CCCO[Si](C)(C)C(C)(C)C)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H38O4SSi/c1-8-10-19(11-9-16-25-27(6,7)21(3,4)5)17-24-26(22,23)20-14-12-18(2)13-15-20/h12-15,19H,8-11,16-17H2,1-7H3/t19-/m1/s1 |
| InChIKey | LGEOGPUNLZRUDN-LJQANCHMSA-N |
| XLogP | 5.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|