C23H42O4SSi — CID 11374137
[(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl] 4-methylbenzenesulfonate (PubChem CID 11374137) has the molecular formula C23H42O4SSi and a molecular weight of 442.74 g/mol. Its IUPAC name is [(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11374137 |
| Molecular Formula | C23H42O4SSi |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | [(2S,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylhexyl] 4-methylbenzenesulfonate |
| SMILES | CC[C@H](C)C[C@@H](COS(=O)(=O)c1ccc(C)cc1)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O4SSi/c1-10-18(3)16-20(22(11-2)27-29(8,9)23(5,6)7)17-26-28(24,25)21-14-12-19(4)13-15-21/h12-15,18,20,22H,10-11,16-17H2,1-9H3/t18-,20-,22+/m0/s1 |
| InChIKey | YVTOLDBHOKJBSJ-RCZSKKKRSA-N |
| XLogP | 6.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|