C23H40O7SSi — CID 157261521
[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-(1-hydroxypropyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] 4-methylbenzenesulfonate (PubChem CID 157261521) has the molecular formula C23H40O7SSi and a molecular weight of 488.72 g/mol. Its IUPAC name is [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-(1-hydroxypropyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-(1-hydroxypropyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 157261521 |
| Molecular Formula | C23H40O7SSi |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-(1-hydroxypropyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl] 4-methylbenzenesulfonate |
| SMILES | CCC(O)[C@H]1OC(C)(C)O[C@H]1[C@@H](COS(=O)(=O)c1ccc(C)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O7SSi/c1-10-18(24)20-21(29-23(6,7)28-20)19(30-32(8,9)22(3,4)5)15-27-31(25,26)17-13-11-16(2)12-14-17/h11-14,18-21,24H,10,15H2,1-9H3/t18?,19-,20-,21+/m1/s1 |
| InChIKey | OYMPWXSWTUFPQY-VKEMMKHGSA-N |
| XLogP | 4.38 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|