C18H32O4SSi — CID 141319014
3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl 4-methylbenzenesulfonate (PubChem CID 141319014) has the molecular formula C18H32O4SSi and a molecular weight of 372.60 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl 4-methylbenzenesulfonate.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 141319014 |
| Molecular Formula | C18H32O4SSi |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl 4-methylbenzenesulfonate |
| SMILES | CCC(O[Si](C)(C)C(C)(C)C)C(C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H32O4SSi/c1-9-17(22-24(7,8)18(4,5)6)15(3)21-23(19,20)16-12-10-14(2)11-13-16/h10-13,15,17H,9H2,1-8H3 |
| InChIKey | WRPNHCHFYYCFSV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|