C19H33NO3SSi — CID 10045518
N-[(E,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl]-4-methylbenzenesulfonamide (PubChem CID 10045518) has the molecular formula C19H33NO3SSi and a molecular weight of 383.63 g/mol. Its IUPAC name is N-[(E,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10045518 |
| Molecular Formula | C19H33NO3SSi |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[(E,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)/C=C/[C@H](C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H33NO3SSi/c1-15-9-13-18(14-10-15)24(21,22)20-16(2)11-12-17(3)23-25(7,8)19(4,5)6/h9-14,16-17,20H,1-8H3/b12-11+/t16-,17-/m0/s1 |
| InChIKey | XKXZQFXSGBEMOM-YFXCHKOLSA-N |
| XLogP | 4.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|