C24H36BrN3O3SSi — CID 45102383
N-[(E)-[2-bromo-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropyl]-3-pyridinyl]methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 45102383) has the molecular formula C24H36BrN3O3SSi and a molecular weight of 554.63 g/mol. Its IUPAC name is N-[(E)-[2-bromo-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropyl]-3-pyridinyl]methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[2-bromo-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropyl]-3-pyridinyl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 45102383 |
| Molecular Formula | C24H36BrN3O3SSi |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | N-[(E)-[2-bromo-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropyl]-3-pyridinyl]methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/c2ccc([C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C)nc2Br)cc1 |
| InChI | InChI=1S/C24H36BrN3O3SSi/c1-17-10-13-19(14-11-17)32(29,30)28-26-16-18-12-15-20(27-22(18)25)21(23(2,3)4)31-33(8,9)24(5,6)7/h10-16,21,28H,1-9H3/b26-16+/t21-/m0/s1 |
| InChIKey | XATODOKDGAHECD-AUEUWSLNSA-N |
| XLogP | 6.57 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|