C18H18N2O3S — CID 3773100
4-methyl-N-[(2-methyl-2H-chromen-3-yl)methylideneamino]benzenesulfonamide (PubChem CID 3773100) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-methyl-N-[(2-methyl-2H-chromen-3-yl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2-methyl-2H-chromen-3-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 3773100 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 4-methyl-N-[(2-methyl-2H-chromen-3-yl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=CC2=Cc3ccccc3OC2C)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-13-7-9-17(10-8-13)24(21,22)20-19-12-16-11-15-5-3-4-6-18(15)23-14(16)2/h3-12,14,20H,1-2H3 |
| InChIKey | RRZYNYDKSPBTTK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|