C31H27N2O2PS — CID 23661314
4-methyl-N-[(Z)-[3-(triphenyl-λ5-phosphanylidene)cyclopenta-1,4-dien-1-yl]methylideneamino]benzenesulfonamide (PubChem CID 23661314) has the molecular formula C31H27N2O2PS and a molecular weight of 522.61 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-[3-(triphenyl-λ5-phosphanylidene)cyclopenta-1,4-dien-1-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(Z)-[3-(triphenyl-λ5-phosphanylidene)cyclopenta-1,4-dien-1-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 23661314 |
| Molecular Formula | C31H27N2O2PS |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 4-methyl-N-[(Z)-[3-(triphenyl-λ5-phosphanylidene)cyclopenta-1,4-dien-1-yl]methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C\C2=CC(=P(c3ccccc3)(c3ccccc3)c3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C31H27N2O2PS/c1-25-17-21-31(22-18-25)37(34,35)33-32-24-26-19-20-30(23-26)36(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-24,33H,1H3/b32-24- |
| InChIKey | NWXRHJFGANGBDX-TZHWMEPESA-N |
| XLogP | 4.92 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|