C22H19ClN2O2S3 — CID 92884126
N-[(E)-[2-chloro-3,3-bis(phenylsulfanyl)prop-2-enylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 92884126) has the molecular formula C22H19ClN2O2S3 and a molecular weight of 475.06 g/mol. Its IUPAC name is N-[(E)-[2-chloro-3,3-bis(phenylsulfanyl)prop-2-enylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[2-chloro-3,3-bis(phenylsulfanyl)prop-2-enylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 92884126 |
| Molecular Formula | C22H19ClN2O2S3 |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | N-[(E)-[2-chloro-3,3-bis(phenylsulfanyl)prop-2-enylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/C(Cl)=C(Sc2ccccc2)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19ClN2O2S3/c1-17-12-14-20(15-13-17)30(26,27)25-24-16-21(23)22(28-18-8-4-2-5-9-18)29-19-10-6-3-7-11-19/h2-16,25H,1H3/b24-16+ |
| InChIKey | XBLALUIZAUNYRL-LFVJCYFKSA-N |
| XLogP | 6.25 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|