C8H10N2O4S2 — CID 162411258
[(4-methylphenyl)sulfonylhydrazinylidene]methanesulfinic acid (PubChem CID 162411258) has the molecular formula C8H10N2O4S2 and a molecular weight of 262.31 g/mol. Its IUPAC name is [(4-methylphenyl)sulfonylhydrazinylidene]methanesulfinic acid.
| Compound Name | [(4-methylphenyl)sulfonylhydrazinylidene]methanesulfinic acid |
|---|---|
| PubChem CID | 162411258 |
| Molecular Formula | C8H10N2O4S2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | [(4-methylphenyl)sulfonylhydrazinylidene]methanesulfinic acid |
| SMILES | Cc1ccc(S(=O)(=O)NN=CS(=O)O)cc1 |
| InChI | InChI=1S/C8H10N2O4S2/c1-7-2-4-8(5-3-7)16(13,14)10-9-6-15(11)12/h2-6,10H,1H3,(H,11,12) |
| InChIKey | FXBJXOAZKFPDHT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|