About bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide
bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide (PubChem CID 123614271) has the molecular formula C10H13BrN2O2S
and a molecular weight of 305.20 g/mol. Its IUPAC name is bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide.
Molecular Properties
| Compound Name | bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide |
| PubChem CID | 123614271 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide |
| SMILES | C=CBr.C=NNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C8H10N2O2S.C2H3Br/c1-7-3-5-8(6-4-7)13(11,12)10-9-2;1-2-3/h3-6,10H,2H2,1H3;2H,1H2 |
| InChIKey | XHRSFHCTDHYEFS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide?
The IUPAC name of bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide (CID 123614271) is bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide.
What is the SMILES notation for bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide?
The canonical SMILES for bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide is C=CBr.C=NNS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide?
The InChIKey is XHRSFHCTDHYEFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S.C2H3Br/c1-7-3-5-8(6-4-7)13(11,12)10-9-2;1-2-3/h3-6,10H,2H2,1H3;2H,1H2.
What are the key properties of bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide?
bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide has a molecular weight of 305.20 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bromoethene;4-methyl-N-(methylideneamino)benzenesulfonamide is sourced from PubChem (CID 123614271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).