C7H8NO4S2- — CID 57311516
1-methyl-4-(sulfinatosulfamoyl)benzene (PubChem CID 57311516) has the molecular formula C7H8NO4S2- and a molecular weight of 234.28 g/mol. Its IUPAC name is 1-methyl-4-(sulfinatosulfamoyl)benzene.
| Compound Name | 1-methyl-4-(sulfinatosulfamoyl)benzene |
|---|---|
| PubChem CID | 57311516 |
| Molecular Formula | C7H8NO4S2- |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 1-methyl-4-(sulfinatosulfamoyl)benzene |
| SMILES | Cc1ccc(S(=O)(=O)NS(=O)[O-])cc1 |
| InChI | InChI=1S/C7H9NO4S2/c1-6-2-4-7(5-3-6)14(11,12)8-13(9)10/h2-5,8H,1H3,(H,9,10)/p-1 |
| InChIKey | KGDCBCQPCARZIV-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|