C13H20N2O6S — CID 170858151
4-methyl-N-[(E)-[(2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexylidene]amino]benzenesulfonamide (PubChem CID 170858151) has the molecular formula C13H20N2O6S and a molecular weight of 332.38 g/mol. Its IUPAC name is 4-methyl-N-[(E)-[(2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexylidene]amino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-[(2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 170858151 |
| Molecular Formula | C13H20N2O6S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-methyl-N-[(E)-[(2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexylidene]amino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/[C@@H](O)[C@H](O)[C@H](O)[C@H](C)O)cc1 |
| InChI | InChI=1S/C13H20N2O6S/c1-8-3-5-10(6-4-8)22(20,21)15-14-7-11(17)13(19)12(18)9(2)16/h3-7,9,11-13,15-19H,1-2H3/b14-7+/t9-,11+,12+,13-/m0/s1 |
| InChIKey | VLBLVBNKLKRXDQ-XIIJBSTASA-N |
| XLogP | -1.28 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|