C19H30N2O2SSi — CID 166436835
4-methyl-N-[(E)-3-tri(propan-2-yl)silylprop-2-ynylideneamino]benzenesulfonamide (PubChem CID 166436835) has the molecular formula C19H30N2O2SSi and a molecular weight of 378.61 g/mol. Its IUPAC name is 4-methyl-N-[(E)-3-tri(propan-2-yl)silylprop-2-ynylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-3-tri(propan-2-yl)silylprop-2-ynylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 166436835 |
| Molecular Formula | C19H30N2O2SSi |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-methyl-N-[(E)-3-tri(propan-2-yl)silylprop-2-ynylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/C#C[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O2SSi/c1-15(2)25(16(3)4,17(5)6)14-8-13-20-21-24(22,23)19-11-9-18(7)10-12-19/h9-13,15-17,21H,1-7H3/b20-13+ |
| InChIKey | IZKQHQCZJSMLOT-DEDYPNTBSA-N |
| XLogP | 4.48 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|