C14H23N2O5PS — CID 11760221
N-[(E)-2-diethoxyphosphorylpropylideneamino]-4-methylbenzenesulfonamide (PubChem CID 11760221) has the molecular formula C14H23N2O5PS and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[(E)-2-diethoxyphosphorylpropylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-2-diethoxyphosphorylpropylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11760221 |
| Molecular Formula | C14H23N2O5PS |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[(E)-2-diethoxyphosphorylpropylideneamino]-4-methylbenzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C(C)/C=N/NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H23N2O5PS/c1-5-20-22(17,21-6-2)13(4)11-15-16-23(18,19)14-9-7-12(3)8-10-14/h7-11,13,16H,5-6H2,1-4H3/b15-11+ |
| InChIKey | AWHRYOUTAQOBDS-RVDMUPIBSA-N |
| XLogP | 2.91 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|