C13H19Cl3NO5PS — CID 11476152
4-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)benzenesulfonamide (PubChem CID 11476152) has the molecular formula C13H19Cl3NO5PS and a molecular weight of 438.70 g/mol. Its IUPAC name is 4-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11476152 |
| Molecular Formula | C13H19Cl3NO5PS |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | 4-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)benzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C(NS(=O)(=O)c1ccc(C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H19Cl3NO5PS/c1-4-21-23(18,22-5-2)12(13(14,15)16)17-24(19,20)11-8-6-10(3)7-9-11/h6-9,12,17H,4-5H2,1-3H3 |
| InChIKey | QWXKDQJLPDLNMN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|