C23H26NO3PS — CID 21427381
N-(1-diphenylphosphorylbutyl)-4-methylbenzenesulfonamide (PubChem CID 21427381) has the molecular formula C23H26NO3PS and a molecular weight of 427.51 g/mol. Its IUPAC name is N-(1-diphenylphosphorylbutyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(1-diphenylphosphorylbutyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 21427381 |
| Molecular Formula | C23H26NO3PS |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-(1-diphenylphosphorylbutyl)-4-methylbenzenesulfonamide |
| SMILES | CCCC(NS(=O)(=O)c1ccc(C)cc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26NO3PS/c1-3-10-23(24-29(26,27)22-17-15-19(2)16-18-22)28(25,20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-9,11-18,23-24H,3,10H2,1-2H3 |
| InChIKey | HKIZXFROJATQMK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|