C18H23NO2S — CID 45102181
4-methyl-N-[(2S)-1-phenylpentan-2-yl]benzenesulfonamide (PubChem CID 45102181) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-1-phenylpentan-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2S)-1-phenylpentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 45102181 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-methyl-N-[(2S)-1-phenylpentan-2-yl]benzenesulfonamide |
| SMILES | CCC[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO2S/c1-3-7-17(14-16-8-5-4-6-9-16)19-22(20,21)18-12-10-15(2)11-13-18/h4-6,8-13,17,19H,3,7,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | RXBQQLTYLVCYQW-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |