C23H25NO5S2 — CID 131668400
[(2R)-1,1-dideuterio-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropyl] 4-methylbenzenesulfonate (PubChem CID 131668400) has the molecular formula C23H25NO5S2 and a molecular weight of 461.60 g/mol. Its IUPAC name is [(2R)-1,1-dideuterio-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-1,1-dideuterio-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 131668400 |
| Molecular Formula | C23H25NO5S2 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [(2R)-1,1-dideuterio-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(OS(=O)(=O)c1ccc(C)cc1)[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H25NO5S2/c1-18-8-12-22(13-9-18)30(25,26)24-21(16-20-6-4-3-5-7-20)17-29-31(27,28)23-14-10-19(2)11-15-23/h3-15,21,24H,16-17H2,1-2H3/t21-/m1/s1/i17D2 |
| InChIKey | QATCEFUUVQOULD-OGOANFNBSA-N |
| XLogP | 3.60 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|