C20H21NO2S2 — CID 93004561
4-methyl-N-[(2S)-1-phenyl-3-thiophen-2-ylpropan-2-yl]benzenesulfonamide (PubChem CID 93004561) has the molecular formula C20H21NO2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-1-phenyl-3-thiophen-2-ylpropan-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2S)-1-phenyl-3-thiophen-2-ylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 93004561 |
| Molecular Formula | C20H21NO2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-methyl-N-[(2S)-1-phenyl-3-thiophen-2-ylpropan-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C20H21NO2S2/c1-16-9-11-20(12-10-16)25(22,23)21-18(15-19-8-5-13-24-19)14-17-6-3-2-4-7-17/h2-13,18,21H,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | MNLBNGRLYSVNDD-SFHVURJKSA-N |
| XLogP | 4.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |