C16H15NO2S3 — CID 12000205
N-(dithiophen-2-ylmethyl)-4-methylbenzenesulfonamide (PubChem CID 12000205) has the molecular formula C16H15NO2S3 and a molecular weight of 349.50 g/mol. Its IUPAC name is N-(dithiophen-2-ylmethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(dithiophen-2-ylmethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 12000205 |
| Molecular Formula | C16H15NO2S3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(dithiophen-2-ylmethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2cccs2)c2cccs2)cc1 |
| InChI | InChI=1S/C16H15NO2S3/c1-12-6-8-13(9-7-12)22(18,19)17-16(14-4-2-10-20-14)15-5-3-11-21-15/h2-11,16-17H,1H3 |
| InChIKey | SYJMCAGKZWAZBO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |