C18H16ClNO2S2 — CID 18279348
3-chloro-N-[(4-methylphenyl)-thiophen-2-ylmethyl]benzenesulfonamide (PubChem CID 18279348) has the molecular formula C18H16ClNO2S2 and a molecular weight of 377.92 g/mol. Its IUPAC name is 3-chloro-N-[(4-methylphenyl)-thiophen-2-ylmethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[(4-methylphenyl)-thiophen-2-ylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18279348 |
| Molecular Formula | C18H16ClNO2S2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 3-chloro-N-[(4-methylphenyl)-thiophen-2-ylmethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(NS(=O)(=O)c2cccc(Cl)c2)c2cccs2)cc1 |
| InChI | InChI=1S/C18H16ClNO2S2/c1-13-7-9-14(10-8-13)18(17-6-3-11-23-17)20-24(21,22)16-5-2-4-15(19)12-16/h2-12,18,20H,1H3 |
| InChIKey | WAJZFYLXWYBISH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |