C17H13Cl2NO2S2 — CID 24678420
2,6-dichloro-N-[phenyl(thiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 24678420) has the molecular formula C17H13Cl2NO2S2 and a molecular weight of 398.34 g/mol. Its IUPAC name is 2,6-dichloro-N-[phenyl(thiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[phenyl(thiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24678420 |
| Molecular Formula | C17H13Cl2NO2S2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 2,6-dichloro-N-[phenyl(thiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(c1ccccc1)c1cccs1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H13Cl2NO2S2/c18-13-8-4-9-14(19)17(13)24(21,22)20-16(15-10-5-11-23-15)12-6-2-1-3-7-12/h1-11,16,20H |
| InChIKey | DEPSOUHBUDRJOQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |