C12H11ClFNO2S2 — CID 63665118
1-chloro-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]methanesulfonamide (PubChem CID 63665118) has the molecular formula C12H11ClFNO2S2 and a molecular weight of 319.81 g/mol. Its IUPAC name is 1-chloro-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]methanesulfonamide |
|---|---|
| PubChem CID | 63665118 |
| Molecular Formula | C12H11ClFNO2S2 |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 1-chloro-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]methanesulfonamide |
| SMILES | O=S(=O)(CCl)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C12H11ClFNO2S2/c13-8-19(16,17)15-12(11-2-1-7-18-11)9-3-5-10(14)6-4-9/h1-7,12,15H,8H2 |
| InChIKey | NHXXQLHMZUMBIY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|