C18H14ClNOS — CID 8820635
4-chloro-N-[(R)-phenyl(thiophen-2-yl)methyl]benzamide (PubChem CID 8820635) has the molecular formula C18H14ClNOS and a molecular weight of 327.84 g/mol. Its IUPAC name is 4-chloro-N-[(R)-phenyl(thiophen-2-yl)methyl]benzamide.
| Compound Name | 4-chloro-N-[(R)-phenyl(thiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 8820635 |
| Molecular Formula | C18H14ClNOS |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-chloro-N-[(R)-phenyl(thiophen-2-yl)methyl]benzamide |
| SMILES | O=C(N[C@H](c1ccccc1)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClNOS/c19-15-10-8-14(9-11-15)18(21)20-17(16-7-4-12-22-16)13-5-2-1-3-6-13/h1-12,17H,(H,20,21)/t17-/m1/s1 |
| InChIKey | FXNPIMSCBWMXBU-QGZVFWFLSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |