C17H14N2O2S — CID 41023450
6-oxo-N-[(R)-phenyl(thiophen-2-yl)methyl]-1H-pyridine-3-carboxamide (PubChem CID 41023450) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 6-oxo-N-[(R)-phenyl(thiophen-2-yl)methyl]-1H-pyridine-3-carboxamide.
| Compound Name | 6-oxo-N-[(R)-phenyl(thiophen-2-yl)methyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 41023450 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 6-oxo-N-[(R)-phenyl(thiophen-2-yl)methyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(N[C@H](c1ccccc1)c1cccs1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C17H14N2O2S/c20-15-9-8-13(11-18-15)17(21)19-16(14-7-4-10-22-14)12-5-2-1-3-6-12/h1-11,16H,(H,18,20)(H,19,21)/t16-/m1/s1 |
| InChIKey | BTIGLTNUGIZOAT-MRXNPFEDSA-N |
| XLogP | 2.96 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |