C20H20N2O3S2 — CID 8853824
4-(dimethylsulfamoyl)-N-[(S)-phenyl(thiophen-2-yl)methyl]benzamide (PubChem CID 8853824) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[(S)-phenyl(thiophen-2-yl)methyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[(S)-phenyl(thiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 8853824 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[(S)-phenyl(thiophen-2-yl)methyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)N[C@@H](c2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H20N2O3S2/c1-22(2)27(24,25)17-12-10-16(11-13-17)20(23)21-19(18-9-6-14-26-18)15-7-4-3-5-8-15/h3-14,19H,1-2H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | LYLMQKNVVIJPBF-IBGZPJMESA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |