C22H23NO2SSe — CID 50993309
4-methyl-N-[(2S)-1-phenyl-3-phenylselanylpropan-2-yl]benzenesulfonamide (PubChem CID 50993309) has the molecular formula C22H23NO2SSe and a molecular weight of 444.46 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-1-phenyl-3-phenylselanylpropan-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2S)-1-phenyl-3-phenylselanylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 50993309 |
| Molecular Formula | C22H23NO2SSe |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 4-methyl-N-[(2S)-1-phenyl-3-phenylselanylpropan-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C[Se]c2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO2SSe/c1-18-12-14-21(15-13-18)26(24,25)23-20(16-19-8-4-2-5-9-19)17-27-22-10-6-3-7-11-22/h2-15,20,23H,16-17H2,1H3/t20-/m0/s1 |
| InChIKey | VYSXQGHVFROYQL-FQEVSTJZSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|