C24H27NO4S — CID 102167974
N-[(2S)-4-[2-(hydroxymethyl)phenoxy]-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 102167974) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[(2S)-4-[2-(hydroxymethyl)phenoxy]-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-4-[2-(hydroxymethyl)phenoxy]-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102167974 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[(2S)-4-[2-(hydroxymethyl)phenoxy]-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CCOc2ccccc2CO)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO4S/c1-19-11-13-23(14-12-19)30(27,28)25-22(17-20-7-3-2-4-8-20)15-16-29-24-10-6-5-9-21(24)18-26/h2-14,22,25-26H,15-18H2,1H3/t22-/m1/s1 |
| InChIKey | VEZVIABGEOCEQX-JOCHJYFZSA-N |
| XLogP | 3.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |