C21H22NO4PS — CID 54172963
4-methyl-N-[1-[phenoxy(phenyl)phosphoryl]ethyl]benzenesulfonamide (PubChem CID 54172963) has the molecular formula C21H22NO4PS and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-methyl-N-[1-[phenoxy(phenyl)phosphoryl]ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-[phenoxy(phenyl)phosphoryl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54172963 |
| Molecular Formula | C21H22NO4PS |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-methyl-N-[1-[phenoxy(phenyl)phosphoryl]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)P(=O)(Oc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22NO4PS/c1-17-13-15-21(16-14-17)28(24,25)22-18(2)27(23,20-11-7-4-8-12-20)26-19-9-5-3-6-10-19/h3-16,18,22H,1-2H3 |
| InChIKey | OWHNXBVODQLAIU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|