C28H28NO5PS — CID 21204749
N-[(3,4-dimethoxyphenyl)-diphenylphosphorylmethyl]-4-methylbenzenesulfonamide (PubChem CID 21204749) has the molecular formula C28H28NO5PS and a molecular weight of 521.58 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)-diphenylphosphorylmethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)-diphenylphosphorylmethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 21204749 |
| Molecular Formula | C28H28NO5PS |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)-diphenylphosphorylmethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(C(NS(=O)(=O)c2ccc(C)cc2)P(=O)(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C28H28NO5PS/c1-21-14-17-25(18-15-21)36(31,32)29-28(22-16-19-26(33-2)27(20-22)34-3)35(30,23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-20,28-29H,1-3H3 |
| InChIKey | ZAUQOWAPKGKPDB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|