C23H24ClNO6S — CID 2316867
N-[bis(3,4-dimethoxyphenyl)methyl]-4-chlorobenzenesulfonamide (PubChem CID 2316867) has the molecular formula C23H24ClNO6S and a molecular weight of 477.97 g/mol. Its IUPAC name is N-[bis(3,4-dimethoxyphenyl)methyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[bis(3,4-dimethoxyphenyl)methyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 2316867 |
| Molecular Formula | C23H24ClNO6S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N-[bis(3,4-dimethoxyphenyl)methyl]-4-chlorobenzenesulfonamide |
| SMILES | COc1ccc(C(NS(=O)(=O)c2ccc(Cl)cc2)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C23H24ClNO6S/c1-28-19-11-5-15(13-21(19)30-3)23(16-6-12-20(29-2)22(14-16)31-4)25-32(26,27)18-9-7-17(24)8-10-18/h5-14,23,25H,1-4H3 |
| InChIKey | OPPWVBPGCZCJBH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |