C16H18ClNO4S — CID 9167712
(2S)-2-(4-chlorophenyl)sulfonyl-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 9167712) has the molecular formula C16H18ClNO4S and a molecular weight of 355.84 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)sulfonyl-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | (2S)-2-(4-chlorophenyl)sulfonyl-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 9167712 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)sulfonyl-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc([C@@H](CN)S(=O)(=O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C16H18ClNO4S/c1-21-14-8-3-11(9-15(14)22-2)16(10-18)23(19,20)13-6-4-12(17)5-7-13/h3-9,16H,10,18H2,1-2H3/t16-/m1/s1 |
| InChIKey | MGRXLSKHQYHCKF-MRXNPFEDSA-N |
| XLogP | 2.83 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |