C23H22ClNO7S — CID 22463227
3-[3-(4-chlorophenoxy)phenyl]-3-(3,4-dimethoxyphenyl)sulfonyl-N-hydroxypropanamide (PubChem CID 22463227) has the molecular formula C23H22ClNO7S and a molecular weight of 491.95 g/mol. Its IUPAC name is 3-[3-(4-chlorophenoxy)phenyl]-3-(3,4-dimethoxyphenyl)sulfonyl-N-hydroxypropanamide.
| Compound Name | 3-[3-(4-chlorophenoxy)phenyl]-3-(3,4-dimethoxyphenyl)sulfonyl-N-hydroxypropanamide |
|---|---|
| PubChem CID | 22463227 |
| Molecular Formula | C23H22ClNO7S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 3-[3-(4-chlorophenoxy)phenyl]-3-(3,4-dimethoxyphenyl)sulfonyl-N-hydroxypropanamide |
| SMILES | COc1ccc(S(=O)(=O)C(CC(=O)NO)c2cccc(Oc3ccc(Cl)cc3)c2)cc1OC |
| InChI | InChI=1S/C23H22ClNO7S/c1-30-20-11-10-19(13-21(20)31-2)33(28,29)22(14-23(26)25-27)15-4-3-5-18(12-15)32-17-8-6-16(24)7-9-17/h3-13,22,27H,14H2,1-2H3,(H,25,26) |
| InChIKey | CXCALDMWTCLXEF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|