C23H21ClFNO5S — CID 67789197
5-[(4-chlorophenyl)sulfonylamino]-3-[3-(4-fluorophenoxy)phenyl]pentanoic acid (PubChem CID 67789197) has the molecular formula C23H21ClFNO5S and a molecular weight of 477.94 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)sulfonylamino]-3-[3-(4-fluorophenoxy)phenyl]pentanoic acid.
| Compound Name | 5-[(4-chlorophenyl)sulfonylamino]-3-[3-(4-fluorophenoxy)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 67789197 |
| Molecular Formula | C23H21ClFNO5S |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 5-[(4-chlorophenyl)sulfonylamino]-3-[3-(4-fluorophenoxy)phenyl]pentanoic acid |
| SMILES | O=C(O)CC(CCNS(=O)(=O)c1ccc(Cl)cc1)c1cccc(Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H21ClFNO5S/c24-18-4-10-22(11-5-18)32(29,30)26-13-12-17(15-23(27)28)16-2-1-3-21(14-16)31-20-8-6-19(25)7-9-20/h1-11,14,17,26H,12-13,15H2,(H,27,28) |
| InChIKey | RBKUMFSQBYKUAP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |