C20H23ClFNO4S — CID 139616948
8-[(4-chlorophenyl)sulfonylamino]-8-(3-fluorophenyl)octanoic acid (PubChem CID 139616948) has the molecular formula C20H23ClFNO4S and a molecular weight of 427.93 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)sulfonylamino]-8-(3-fluorophenyl)octanoic acid.
| Compound Name | 8-[(4-chlorophenyl)sulfonylamino]-8-(3-fluorophenyl)octanoic acid |
|---|---|
| PubChem CID | 139616948 |
| Molecular Formula | C20H23ClFNO4S |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 8-[(4-chlorophenyl)sulfonylamino]-8-(3-fluorophenyl)octanoic acid |
| SMILES | O=C(O)CCCCCCC(NS(=O)(=O)c1ccc(Cl)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H23ClFNO4S/c21-16-10-12-18(13-11-16)28(26,27)23-19(15-6-5-7-17(22)14-15)8-3-1-2-4-9-20(24)25/h5-7,10-14,19,23H,1-4,8-9H2,(H,24,25) |
| InChIKey | XJVTUQOWWKZPKY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|