C23H21ClFNO4S — CID 10837737
4-[4-[[(4-chlorophenyl)sulfonylamino]-(3-fluorophenyl)methyl]phenyl]butanoic acid (PubChem CID 10837737) has the molecular formula C23H21ClFNO4S and a molecular weight of 461.94 g/mol. Its IUPAC name is 4-[4-[[(4-chlorophenyl)sulfonylamino]-(3-fluorophenyl)methyl]phenyl]butanoic acid.
| Compound Name | 4-[4-[[(4-chlorophenyl)sulfonylamino]-(3-fluorophenyl)methyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 10837737 |
| Molecular Formula | C23H21ClFNO4S |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 4-[4-[[(4-chlorophenyl)sulfonylamino]-(3-fluorophenyl)methyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(C(NS(=O)(=O)c2ccc(Cl)cc2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C23H21ClFNO4S/c24-19-11-13-21(14-12-19)31(29,30)26-23(18-4-2-5-20(25)15-18)17-9-7-16(8-10-17)3-1-6-22(27)28/h2,4-5,7-15,23,26H,1,3,6H2,(H,27,28) |
| InChIKey | POAGLHQQAYJHHQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |